About N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide
N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide (PubChem CID 106350056) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide |
| PubChem CID | 106350056 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)COC1CCNCC1 |
| InChI | InChI=1S/C14H28N2O3/c1-14(2,3)12(6-9-17)16-13(18)10-19-11-4-7-15-8-5-11/h11-12,15,17H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | UEODDEQFQPSAFZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide?
The IUPAC name of N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide (CID 106350056) is N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide.
What is the SMILES notation for N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide?
The canonical SMILES for N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide is CC(C)(C)C(CCO)NC(=O)COC1CCNCC1.
What is the InChIKey of N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide?
The InChIKey is UEODDEQFQPSAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-14(2,3)12(6-9-17)16-13(18)10-19-11-4-7-15-8-5-11/h11-12,15,17H,4-10H2,1-3H3,(H,16,18).
What are the key properties of N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide?
N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide has a molecular weight of 272.39 g/mol, XLogP of 0.67, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-piperidin-4-yloxyacetamide is sourced from PubChem (CID 106350056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).