C16H27N3O2 — CID 106350288
N'-hydroxy-4-[[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]methyl]-3-methylbenzenecarboximidamide (PubChem CID 106350288) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N'-hydroxy-4-[[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]methyl]-3-methylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 106350288 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N'-hydroxy-4-[[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]methyl]-3-methylbenzenecarboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)ccc1CNC(CCO)C(C)(C)C |
| InChI | InChI=1S/C16H27N3O2/c1-11-9-12(15(17)19-21)5-6-13(11)10-18-14(7-8-20)16(2,3)4/h5-6,9,14,18,20-21H,7-8,10H2,1-4H3,(H2,17,19) |
| InChIKey | LZILQSJZJSOMBQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|