About 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one
7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 10635098) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 10635098 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | CC1=NC(CC(C)C)C(=O)N(C)c2ccc(O)cc21 |
| InChI | InChI=1S/C15H20N2O2/c1-9(2)7-13-15(19)17(4)14-6-5-11(18)8-12(14)10(3)16-13/h5-6,8-9,13,18H,7H2,1-4H3 |
| InChIKey | BLCCYAMBTNSBLW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one (CID 10635098) is 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one is CC1=NC(CC(C)C)C(=O)N(C)c2ccc(O)cc21.
What is the InChIKey of 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one?
The InChIKey is BLCCYAMBTNSBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-9(2)7-13-15(19)17(4)14-6-5-11(18)8-12(14)10(3)16-13/h5-6,8-9,13,18H,7H2,1-4H3.
What are the key properties of 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one?
7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one has a molecular weight of 260.34 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1,5-dimethyl-3-(2-methylpropyl)-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 10635098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).