About N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine
N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 106351301) has the molecular formula C14H19FN2S
and a molecular weight of 266.38 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 106351301 |
| Molecular Formula | C14H19FN2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | Cc1cc(F)ccc1NC1=NC(C(C)C)CCS1 |
| InChI | InChI=1S/C14H19FN2S/c1-9(2)12-6-7-18-14(16-12)17-13-5-4-11(15)8-10(13)3/h4-5,8-9,12H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | YFPWLXGPCRGCMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 106351301) is N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is Cc1cc(F)ccc1NC1=NC(C(C)C)CCS1.
What is the InChIKey of N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is YFPWLXGPCRGCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2S/c1-9(2)12-6-7-18-14(16-12)17-13-5-4-11(15)8-10(13)3/h4-5,8-9,12H,6-7H2,1-3H3,(H,16,17).
What are the key properties of N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 266.38 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluoro-2-methylphenyl)-4-propan-2-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 106351301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).