About 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]
5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (PubChem CID 10635163) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
Molecular Properties
| Compound Name | 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| PubChem CID | 10635163 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| SMILES | CCCN1CCCC12COc1cccc(OC)c1C2 |
| InChI | InChI=1S/C16H23NO2/c1-3-9-17-10-5-8-16(17)11-13-14(18-2)6-4-7-15(13)19-12-16/h4,6-7H,3,5,8-12H2,1-2H3 |
| InChIKey | VNEQQDVYANFDGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The IUPAC name of 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (CID 10635163) is 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
What is the SMILES notation for 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The canonical SMILES for 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is CCCN1CCCC12COc1cccc(OC)c1C2.
What is the InChIKey of 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The InChIKey is VNEQQDVYANFDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-3-9-17-10-5-8-16(17)11-13-14(18-2)6-4-7-15(13)19-12-16/h4,6-7H,3,5,8-12H2,1-2H3.
What are the key properties of 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] has a molecular weight of 261.37 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is sourced from PubChem (CID 10635163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).