C12H10N2O5 — CID 10635185
3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10635185) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10635185 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N1CCOC1=O |
| InChI | InChI=1S/C12H10N2O5/c15-11(13-7-8-19-12(13)16)6-3-9-1-4-10(5-2-9)14(17)18/h1-6H,7-8H2/b6-3+ |
| InChIKey | UUIIKDDVGAUQHV-ZZXKWVIFSA-N |
| XLogP | 1.59 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|