C12H14F4N2 — CID 10635188
4-N-cyclohexyl-2,3,5,6-tetrafluorobenzene-1,4-diamine (PubChem CID 10635188) has the molecular formula C12H14F4N2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 4-N-cyclohexyl-2,3,5,6-tetrafluorobenzene-1,4-diamine.
| Compound Name | 4-N-cyclohexyl-2,3,5,6-tetrafluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 10635188 |
| Molecular Formula | C12H14F4N2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-N-cyclohexyl-2,3,5,6-tetrafluorobenzene-1,4-diamine |
| SMILES | Nc1c(F)c(F)c(NC2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C12H14F4N2/c13-7-9(15)12(10(16)8(14)11(7)17)18-6-4-2-1-3-5-6/h6,18H,1-5,17H2 |
| InChIKey | CMPNYFHPJBDADF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|