C17H27NO2 — CID 106352789
5-tert-butyl-2-(2-ethoxyphenyl)-1,4-oxazepane (PubChem CID 106352789) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-tert-butyl-2-(2-ethoxyphenyl)-1,4-oxazepane.
| Compound Name | 5-tert-butyl-2-(2-ethoxyphenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 106352789 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 5-tert-butyl-2-(2-ethoxyphenyl)-1,4-oxazepane |
| SMILES | CCOc1ccccc1C1CNC(C(C)(C)C)CCO1 |
| InChI | InChI=1S/C17H27NO2/c1-5-19-14-9-7-6-8-13(14)15-12-18-16(10-11-20-15)17(2,3)4/h6-9,15-16,18H,5,10-12H2,1-4H3 |
| InChIKey | IDZISARNLAKUKQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |