C9H19F3N2O3S — CID 106353447
4,4-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol (PubChem CID 106353447) has the molecular formula C9H19F3N2O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4,4-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106353447 |
| Molecular Formula | C9H19F3N2O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4,4-dimethyl-3-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O3S/c1-8(2,3)7(4-5-15)14-18(16,17)13-6-9(10,11)12/h7,13-15H,4-6H2,1-3H3 |
| InChIKey | YUWDQHXSWQEACN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |