About 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile
4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile (PubChem CID 10635397) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile |
| PubChem CID | 10635397 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2Oc3ccccc3C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H11NO3/c17-9-10-5-7-11(8-6-10)16-15(19)14(18)12-3-1-2-4-13(12)20-16/h1-8,15-16,19H/t15-,16+/m0/s1 |
| InChIKey | OYHOHSXKPXJUJR-JKSUJKDBSA-N |
| XLogP | 2.24 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile?
The IUPAC name of 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile (CID 10635397) is 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile.
What is the SMILES notation for 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile?
The canonical SMILES for 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile is N#Cc1ccc([C@H]2Oc3ccccc3C(=O)[C@@H]2O)cc1.
What is the InChIKey of 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile?
The InChIKey is OYHOHSXKPXJUJR-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H11NO3/c17-9-10-5-7-11(8-6-10)16-15(19)14(18)12-3-1-2-4-13(12)20-16/h1-8,15-16,19H/t15-,16+/m0/s1.
What are the key properties of 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile?
4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile has a molecular weight of 265.27 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3R)-3-hydroxy-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile is sourced from PubChem (CID 10635397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).