About (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one
(3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 10635478) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| PubChem CID | 10635478 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | CCc1c(/C=C2\C(=O)Nc3ccccc32)[nH]c(C)c1C |
| InChI | InChI=1S/C17H18N2O/c1-4-12-10(2)11(3)18-16(12)9-14-13-7-5-6-8-15(13)19-17(14)20/h5-9,18H,4H2,1-3H3,(H,19,20)/b14-9- |
| InChIKey | HKJUJLRPOAIDLV-ZROIWOOFSA-N |
| XLogP | 3.69 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (CID 10635478) is (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one is CCc1c(/C=C2\C(=O)Nc3ccccc32)[nH]c(C)c1C.
What is the InChIKey of (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one?
The InChIKey is HKJUJLRPOAIDLV-ZROIWOOFSA-N. The full InChI is InChI=1S/C17H18N2O/c1-4-12-10(2)11(3)18-16(12)9-14-13-7-5-6-8-15(13)19-17(14)20/h5-9,18H,4H2,1-3H3,(H,19,20)/b14-9-.
What are the key properties of (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one?
(3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one has a molecular weight of 266.34 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(3-ethyl-4,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one is sourced from PubChem (CID 10635478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).