C16H22ClNO2 — CID 106354878
N-(1-chloro-4-methylpentan-3-yl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 106354878) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 106354878 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CC(C)C(CCCl)NC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H22ClNO2/c1-11(2)14(7-8-17)18-16(19)13-9-12-5-3-4-6-15(12)20-10-13/h3-6,11,13-14H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | YTYGTFJBQXIDAV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|