About N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide
N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide (PubChem CID 106354991) has the molecular formula C10H17ClF3NO
and a molecular weight of 259.70 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide |
| PubChem CID | 106354991 |
| Molecular Formula | C10H17ClF3NO |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide |
| SMILES | CC(C)C(CCCl)NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H17ClF3NO/c1-7(2)8(4-6-11)15-9(16)3-5-10(12,13)14/h7-8H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | YJZHXOCSKKPZAN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide?
The IUPAC name of N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide (CID 106354991) is N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide?
The canonical SMILES for N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide is CC(C)C(CCCl)NC(=O)CCC(F)(F)F.
What is the InChIKey of N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide?
The InChIKey is YJZHXOCSKKPZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClF3NO/c1-7(2)8(4-6-11)15-9(16)3-5-10(12,13)14/h7-8H,3-6H2,1-2H3,(H,15,16).
What are the key properties of N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide?
N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide has a molecular weight of 259.70 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-4-methylpentan-3-yl)-4,4,4-trifluorobutanamide is sourced from PubChem (CID 106354991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).