C15H26ClN3O — CID 106355702
N-(1-chloro-4,4-dimethylpentan-3-yl)-1,3-diethylpyrazole-5-carboxamide (PubChem CID 106355702) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-1,3-diethylpyrazole-5-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,3-diethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 106355702 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,3-diethylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NC(CCCl)C(C)(C)C)n(CC)n1 |
| InChI | InChI=1S/C15H26ClN3O/c1-6-11-10-12(19(7-2)18-11)14(20)17-13(8-9-16)15(3,4)5/h10,13H,6-9H2,1-5H3,(H,17,20) |
| InChIKey | CGGZYYCLGZDSDO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|