C16H22ClNOS — CID 106355848
N-(1-chloro-4,4-dimethylpentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 106355848) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106355848 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H22ClNOS/c1-16(2,3)14(8-9-17)18-15(19)13-10-11-6-4-5-7-12(11)20-13/h4-7,13-14H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | QZIYMCRQGQFKRJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|