About 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide
5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide (PubChem CID 106356549) has the molecular formula C10H18BrClN4O2S
and a molecular weight of 373.70 g/mol. Its IUPAC name is 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide |
| PubChem CID | 106356549 |
| Molecular Formula | C10H18BrClN4O2S |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC(CCCl)C(C)(C)C |
| InChI | InChI=1S/C10H18BrClN4O2S/c1-10(2,3)7(5-6-12)14-19(17,18)9-8(11)13-15-16(9)4/h7,14H,5-6H2,1-4H3 |
| InChIKey | XFOGENLGFVMTDU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide?
The IUPAC name of 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide (CID 106356549) is 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide?
The canonical SMILES for 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide is Cn1nnc(Br)c1S(=O)(=O)NC(CCCl)C(C)(C)C.
What is the InChIKey of 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide?
The InChIKey is XFOGENLGFVMTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BrClN4O2S/c1-10(2,3)7(5-6-12)14-19(17,18)9-8(11)13-15-16(9)4/h7,14H,5-6H2,1-4H3.
What are the key properties of 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide?
5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide has a molecular weight of 373.70 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methyltriazole-4-sulfonamide is sourced from PubChem (CID 106356549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).