C11H21BrF3NO2S — CID 106356632
N-(1-bromo-4,4-dimethylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106356632) has the molecular formula C11H21BrF3NO2S and a molecular weight of 368.26 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106356632 |
| Molecular Formula | C11H21BrF3NO2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(C)(C)C(CCBr)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H21BrF3NO2S/c1-10(2,3)9(5-7-12)16-19(17,18)8-4-6-11(13,14)15/h9,16H,4-8H2,1-3H3 |
| InChIKey | ARJBECMIEXZXED-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|