About N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide
N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide (PubChem CID 106357140) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide.
Molecular Properties
| Compound Name | N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide |
| PubChem CID | 106357140 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide |
| SMILES | COCCC(=O)NC(CCN)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-11(2,3)9(5-7-12)13-10(14)6-8-15-4/h9H,5-8,12H2,1-4H3,(H,13,14) |
| InChIKey | MCVHLTBUGBADPT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide?
The IUPAC name of N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide (CID 106357140) is N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide.
What is the SMILES notation for N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide?
The canonical SMILES for N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide is COCCC(=O)NC(CCN)C(C)(C)C.
What is the InChIKey of N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide?
The InChIKey is MCVHLTBUGBADPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-11(2,3)9(5-7-12)13-10(14)6-8-15-4/h9H,5-8,12H2,1-4H3,(H,13,14).
What are the key properties of N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide?
N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide has a molecular weight of 216.32 g/mol, XLogP of 0.90, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-4,4-dimethylpentan-3-yl)-3-methoxypropanamide is sourced from PubChem (CID 106357140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).