C17H21NO2 — CID 10635842
(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one (PubChem CID 10635842) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 10635842 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@H](NCC3)C2=O |
| InChI | InChI=1S/C17H21NO2/c1-20-11-5-6-12-14(10-11)17-7-3-2-4-13(17)15(16(12)19)18-9-8-17/h5-6,10,13,15,18H,2-4,7-9H2,1H3/t13-,15-,17+/m0/s1 |
| InChIKey | HPLRGHPULWMCLT-JLJPHGGASA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |