About CID 10635845
CID 10635845 (PubChem CID 10635845) has the molecular formula C17H23N2O
and a molecular weight of 271.38 g/mol.
Molecular Properties
| Compound Name | CID 10635845 |
| PubChem CID | 10635845 |
| Molecular Formula | C17H23N2O |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | — |
| SMILES | CC1(C)C=C(CN2Cc3ccccc3C2)C(C)(C)N1[O] |
| InChI | InChI=1S/C17H23N2O/c1-16(2)9-15(17(3,4)19(16)20)12-18-10-13-7-5-6-8-14(13)11-18/h5-9H,10-12H2,1-4H3 |
| InChIKey | BBLXVGDGEXXEIW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 10635845 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10635845?
The IUPAC name of CID 10635845 (CID 10635845) is not available.
What is the SMILES notation for CID 10635845?
The canonical SMILES for CID 10635845 is CC1(C)C=C(CN2Cc3ccccc3C2)C(C)(C)N1[O].
What is the InChIKey of CID 10635845?
The InChIKey is BBLXVGDGEXXEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N2O/c1-16(2)9-15(17(3,4)19(16)20)12-18-10-13-7-5-6-8-14(13)11-18/h5-9H,10-12H2,1-4H3.
What are the key properties of CID 10635845?
CID 10635845 has a molecular weight of 271.38 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10635845 is sourced from PubChem (CID 10635845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).