About 3-benzylsulfanyl-2H-1,4-benzothiazine
3-benzylsulfanyl-2H-1,4-benzothiazine (PubChem CID 10635857) has the molecular formula C15H13NS2
and a molecular weight of 271.41 g/mol. Its IUPAC name is 3-benzylsulfanyl-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 3-benzylsulfanyl-2H-1,4-benzothiazine |
| PubChem CID | 10635857 |
| Molecular Formula | C15H13NS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-benzylsulfanyl-2H-1,4-benzothiazine |
| SMILES | c1ccc(CSC2=Nc3ccccc3SC2)cc1 |
| InChI | InChI=1S/C15H13NS2/c1-2-6-12(7-3-1)10-18-15-11-17-14-9-5-4-8-13(14)16-15/h1-9H,10-11H2 |
| InChIKey | HSEGOCRRMFVSQQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzylsulfanyl-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfanyl-2H-1,4-benzothiazine?
The IUPAC name of 3-benzylsulfanyl-2H-1,4-benzothiazine (CID 10635857) is 3-benzylsulfanyl-2H-1,4-benzothiazine.
What is the SMILES notation for 3-benzylsulfanyl-2H-1,4-benzothiazine?
The canonical SMILES for 3-benzylsulfanyl-2H-1,4-benzothiazine is c1ccc(CSC2=Nc3ccccc3SC2)cc1.
What is the InChIKey of 3-benzylsulfanyl-2H-1,4-benzothiazine?
The InChIKey is HSEGOCRRMFVSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NS2/c1-2-6-12(7-3-1)10-18-15-11-17-14-9-5-4-8-13(14)16-15/h1-9H,10-11H2.
What are the key properties of 3-benzylsulfanyl-2H-1,4-benzothiazine?
3-benzylsulfanyl-2H-1,4-benzothiazine has a molecular weight of 271.41 g/mol, XLogP of 4.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfanyl-2H-1,4-benzothiazine is sourced from PubChem (CID 10635857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).