C15H21N3OS — CID 106359673
[2-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]cyclohexyl]methanol (PubChem CID 106359673) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is [2-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]cyclohexyl]methanol.
| Compound Name | [2-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106359673 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [2-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]cyclohexyl]methanol |
| SMILES | OCC1CCCCC1NCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C15H21N3OS/c19-10-11-4-1-2-5-13(11)16-8-12-9-17-18-15(12)14-6-3-7-20-14/h3,6-7,9,11,13,16,19H,1-2,4-5,8,10H2,(H,17,18) |
| InChIKey | CBZVZJXPBKUAFR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |