About [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol
[2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol (PubChem CID 106359935) has the molecular formula C13H25F3N2O
and a molecular weight of 282.35 g/mol. Its IUPAC name is [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol |
| PubChem CID | 106359935 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol |
| SMILES | CC(CN)(CCCC(F)(F)F)NC1CCCC1CO |
| InChI | InChI=1S/C13H25F3N2O/c1-12(9-17,6-3-7-13(14,15)16)18-11-5-2-4-10(11)8-19/h10-11,18-19H,2-9,17H2,1H3 |
| InChIKey | BNYUUIKFTKFVHF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol?
The IUPAC name of [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol (CID 106359935) is [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol.
What is the SMILES notation for [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol?
The canonical SMILES for [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol is CC(CN)(CCCC(F)(F)F)NC1CCCC1CO.
What is the InChIKey of [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol?
The InChIKey is BNYUUIKFTKFVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3N2O/c1-12(9-17,6-3-7-13(14,15)16)18-11-5-2-4-10(11)8-19/h10-11,18-19H,2-9,17H2,1H3.
What are the key properties of [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol?
[2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol has a molecular weight of 282.35 g/mol, XLogP of 2.19, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1-amino-6,6,6-trifluoro-2-methylhexan-2-yl)amino]cyclopentyl]methanol is sourced from PubChem (CID 106359935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).