C12H24N2O2 — CID 106360446
[2-[[3-(aminomethyl)oxolan-3-yl]amino]cyclohexyl]methanol (PubChem CID 106360446) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is [2-[[3-(aminomethyl)oxolan-3-yl]amino]cyclohexyl]methanol.
| Compound Name | [2-[[3-(aminomethyl)oxolan-3-yl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106360446 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [2-[[3-(aminomethyl)oxolan-3-yl]amino]cyclohexyl]methanol |
| SMILES | NCC1(NC2CCCCC2CO)CCOC1 |
| InChI | InChI=1S/C12H24N2O2/c13-8-12(5-6-16-9-12)14-11-4-2-1-3-10(11)7-15/h10-11,14-15H,1-9,13H2 |
| InChIKey | CCZVICXWRSILIY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |