C17H26N2O — CID 10636075
6-[(3aR,9bS)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]hexan-1-amine (PubChem CID 10636075) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 6-[(3aR,9bS)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]hexan-1-amine.
| Compound Name | 6-[(3aR,9bS)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]hexan-1-amine |
|---|---|
| PubChem CID | 10636075 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 6-[(3aR,9bS)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]hexan-1-amine |
| SMILES | NCCCCCCN1CC[C@H]2COc3ccccc3[C@H]21 |
| InChI | InChI=1S/C17H26N2O/c18-10-5-1-2-6-11-19-12-9-14-13-20-16-8-4-3-7-15(16)17(14)19/h3-4,7-8,14,17H,1-2,5-6,9-13,18H2/t14-,17-/m0/s1 |
| InChIKey | KFXBBYILQQMVHC-YOEHRIQHSA-N |
| XLogP | 2.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|