C16H23NO2 — CID 106362345
1-[4-[[2-(hydroxymethyl)cyclohexyl]amino]phenyl]propan-1-one (PubChem CID 106362345) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[4-[[2-(hydroxymethyl)cyclohexyl]amino]phenyl]propan-1-one.
| Compound Name | 1-[4-[[2-(hydroxymethyl)cyclohexyl]amino]phenyl]propan-1-one |
|---|---|
| PubChem CID | 106362345 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[4-[[2-(hydroxymethyl)cyclohexyl]amino]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(NC2CCCCC2CO)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-2-16(19)12-7-9-14(10-8-12)17-15-6-4-3-5-13(15)11-18/h7-10,13,15,17-18H,2-6,11H2,1H3 |
| InChIKey | BEJHEXHVOHPSQZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |