C16H22N2S — CID 106362593
N-(1-phenylethyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106362593) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(1-phenylethyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(1-phenylethyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106362593 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(1-phenylethyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | CC(NC1=NC2CCCCC2CS1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2S/c1-12(13-7-3-2-4-8-13)17-16-18-15-10-6-5-9-14(15)11-19-16/h2-4,7-8,12,14-15H,5-6,9-11H2,1H3,(H,17,18) |
| InChIKey | REJXHUMAWISQGT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |