C12H22N2OS — CID 106362637
N-(1-methoxypropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106362637) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106362637 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | COCC(C)NC1=NC2CCCCC2CS1 |
| InChI | InChI=1S/C12H22N2OS/c1-9(7-15-2)13-12-14-11-6-4-3-5-10(11)8-16-12/h9-11H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | SDTFVWVNOUMLND-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |