C14H14F2N2O2S — CID 106362708
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 106362708) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 106362708 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | FC1(F)Oc2ccc(NC3=NC4CCCC4CS3)cc2O1 |
| InChI | InChI=1S/C14H14F2N2O2S/c15-14(16)19-11-5-4-9(6-12(11)20-14)17-13-18-10-3-1-2-8(10)7-21-13/h4-6,8,10H,1-3,7H2,(H,17,18) |
| InChIKey | HAHOXTZIHGSEGR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |