C15H27N3OS — CID 106363013
N-(1-morpholin-4-ylpropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106363013) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-(1-morpholin-4-ylpropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(1-morpholin-4-ylpropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106363013 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-(1-morpholin-4-ylpropan-2-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | CC(CN1CCOCC1)NC1=NC2CCCCC2CS1 |
| InChI | InChI=1S/C15H27N3OS/c1-12(10-18-6-8-19-9-7-18)16-15-17-14-5-3-2-4-13(14)11-20-15/h12-14H,2-11H2,1H3,(H,16,17) |
| InChIKey | WZOVEOPXWHMVSR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |