About hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate
hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate (PubChem CID 10636306) has the molecular formula C14H24F2O3
and a molecular weight of 278.34 g/mol. Its IUPAC name is hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate.
Molecular Properties
| Compound Name | hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate |
| PubChem CID | 10636306 |
| Molecular Formula | C14H24F2O3 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate |
| SMILES | CCCCCCOC(=O)C(F)(F)C1(O)CCCCC1 |
| InChI | InChI=1S/C14H24F2O3/c1-2-3-4-8-11-19-12(17)14(15,16)13(18)9-6-5-7-10-13/h18H,2-11H2,1H3 |
| InChIKey | XXKHREBGHKGUAH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate?
The IUPAC name of hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate (CID 10636306) is hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate.
What is the SMILES notation for hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate?
The canonical SMILES for hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate is CCCCCCOC(=O)C(F)(F)C1(O)CCCCC1.
What is the InChIKey of hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate?
The InChIKey is XXKHREBGHKGUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F2O3/c1-2-3-4-8-11-19-12(17)14(15,16)13(18)9-6-5-7-10-13/h18H,2-11H2,1H3.
What are the key properties of hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate?
hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate has a molecular weight of 278.34 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2,2-difluoro-2-(1-hydroxycyclohexyl)acetate is sourced from PubChem (CID 10636306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).