C15H29N3S — CID 106363166
2-N-(4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-yl)-1-N,1-N-diethylpropane-1,2-diamine (PubChem CID 106363166) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is 2-N-(4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-yl)-1-N,1-N-diethylpropane-1,2-diamine.
| Compound Name | 2-N-(4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-yl)-1-N,1-N-diethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 106363166 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-N-(4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-yl)-1-N,1-N-diethylpropane-1,2-diamine |
| SMILES | CCN(CC)CC(C)NC1=NC2CCCCC2CS1 |
| InChI | InChI=1S/C15H29N3S/c1-4-18(5-2)10-12(3)16-15-17-14-9-7-6-8-13(14)11-19-15/h12-14H,4-11H2,1-3H3,(H,16,17) |
| InChIKey | LFMQTUVNBYZLNV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |