C13H24N4S — CID 106363573
N-(4-methylpiperazin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106363573) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106363573 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | CN1CCN(NC2=NC3CCCCC3CS2)CC1 |
| InChI | InChI=1S/C13H24N4S/c1-16-6-8-17(9-7-16)15-13-14-12-5-3-2-4-11(12)10-18-13/h11-12H,2-10H2,1H3,(H,14,15) |
| InChIKey | YETQHXPRLYZRTN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |