C14H24N2OS — CID 106363714
N-(4-methyloxan-4-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106363714) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is N-(4-methyloxan-4-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(4-methyloxan-4-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106363714 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(4-methyloxan-4-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | CC1(NC2=NC3CCCCC3CS2)CCOCC1 |
| InChI | InChI=1S/C14H24N2OS/c1-14(6-8-17-9-7-14)16-13-15-12-5-3-2-4-11(12)10-18-13/h11-12H,2-10H2,1H3,(H,15,16) |
| InChIKey | HEWFFYVMAFPDRT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |