C13H22N2OS — CID 106363918
N-(3-methoxycyclopentyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 106363918) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N-(3-methoxycyclopentyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(3-methoxycyclopentyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 106363918 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-(3-methoxycyclopentyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | COC1CCC(NC2=NC3CCCC3CS2)C1 |
| InChI | InChI=1S/C13H22N2OS/c1-16-11-6-5-10(7-11)14-13-15-12-4-2-3-9(12)8-17-13/h9-12H,2-8H2,1H3,(H,14,15) |
| InChIKey | MJEPWRBNYYRADD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |