C15H25N3O2 — CID 106364536
1,3-diethyl-N-[2-(hydroxymethyl)cyclohexyl]pyrazole-5-carboxamide (PubChem CID 106364536) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1,3-diethyl-N-[2-(hydroxymethyl)cyclohexyl]pyrazole-5-carboxamide.
| Compound Name | 1,3-diethyl-N-[2-(hydroxymethyl)cyclohexyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 106364536 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1,3-diethyl-N-[2-(hydroxymethyl)cyclohexyl]pyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NC2CCCCC2CO)n(CC)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-3-12-9-14(18(4-2)17-12)15(20)16-13-8-6-5-7-11(13)10-19/h9,11,13,19H,3-8,10H2,1-2H3,(H,16,20) |
| InChIKey | GTHUZIIRYPCGJI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |