C12H20ClN3 — CID 106365328
2-(chloromethyl)-N-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine (PubChem CID 106365328) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is 2-(chloromethyl)-N-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine.
| Compound Name | 2-(chloromethyl)-N-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 106365328 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-(chloromethyl)-N-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine |
| SMILES | Cn1cc(CNC2CCCCC2CCl)cn1 |
| InChI | InChI=1S/C12H20ClN3/c1-16-9-10(8-15-16)7-14-12-5-3-2-4-11(12)6-13/h8-9,11-12,14H,2-7H2,1H3 |
| InChIKey | NZVSQESEOBCPOT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|