C13H19ClN2O — CID 106365414
N-[2-(chloromethyl)cyclopentyl]-6-ethoxypyridin-2-amine (PubChem CID 106365414) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclopentyl]-6-ethoxypyridin-2-amine.
| Compound Name | N-[2-(chloromethyl)cyclopentyl]-6-ethoxypyridin-2-amine |
|---|---|
| PubChem CID | 106365414 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-[2-(chloromethyl)cyclopentyl]-6-ethoxypyridin-2-amine |
| SMILES | CCOc1cccc(NC2CCCC2CCl)n1 |
| InChI | InChI=1S/C13H19ClN2O/c1-2-17-13-8-4-7-12(16-13)15-11-6-3-5-10(11)9-14/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,15,16) |
| InChIKey | DOGCTCSODMCMHB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|