C11H13BrClNO2 — CID 106365773
2-bromo-N-[2-(chloromethyl)cyclopentyl]furan-3-carboxamide (PubChem CID 106365773) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is 2-bromo-N-[2-(chloromethyl)cyclopentyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[2-(chloromethyl)cyclopentyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106365773 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2-bromo-N-[2-(chloromethyl)cyclopentyl]furan-3-carboxamide |
| SMILES | O=C(NC1CCCC1CCl)c1ccoc1Br |
| InChI | InChI=1S/C11H13BrClNO2/c12-10-8(4-5-16-10)11(15)14-9-3-1-2-7(9)6-13/h4-5,7,9H,1-3,6H2,(H,14,15) |
| InChIKey | RKJBKDFDWOBUSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|