About 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline
6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline (PubChem CID 10636583) has the molecular formula C14H20BrN
and a molecular weight of 282.23 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline.
Molecular Properties
| Compound Name | 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline |
| PubChem CID | 10636583 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline |
| SMILES | CC(C)N1CCC(C)(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H20BrN/c1-10(2)16-8-7-14(3,4)12-9-11(15)5-6-13(12)16/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | PRLUJZFVLBPEOL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline?
The IUPAC name of 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline (CID 10636583) is 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline.
What is the SMILES notation for 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline?
The canonical SMILES for 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline is CC(C)N1CCC(C)(C)c2cc(Br)ccc21.
What is the InChIKey of 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline?
The InChIKey is PRLUJZFVLBPEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrN/c1-10(2)16-8-7-14(3,4)12-9-11(15)5-6-13(12)16/h5-6,9-10H,7-8H2,1-4H3.
What are the key properties of 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline?
6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline has a molecular weight of 282.23 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline is sourced from PubChem (CID 10636583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).