About tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate
tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate (PubChem CID 10636604) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate |
| PubChem CID | 10636604 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate |
| SMILES | CCOc1c(C)c(=O)[nH]nc(C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C13H18N2O5/c1-6-19-10-7(2)11(17)15-14-8(9(10)16)12(18)20-13(3,4)5/h6H2,1-5H3,(H,15,17) |
| InChIKey | VBAOQVGFGLSESH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate?
The IUPAC name of tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate (CID 10636604) is tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate.
What is the SMILES notation for tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate?
The canonical SMILES for tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate is CCOc1c(C)c(=O)[nH]nc(C(=O)OC(C)(C)C)c1=O.
What is the InChIKey of tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate?
The InChIKey is VBAOQVGFGLSESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-6-19-10-7(2)11(17)15-14-8(9(10)16)12(18)20-13(3,4)5/h6H2,1-5H3,(H,15,17).
What are the key properties of tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate?
tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate has a molecular weight of 282.30 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-ethoxy-6-methyl-4,7-dioxo-1H-diazepine-3-carboxylate is sourced from PubChem (CID 10636604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).