C11H18ClNO — CID 106366126
N-[2-(chloromethyl)cyclopentyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 106366126) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclopentyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[2-(chloromethyl)cyclopentyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 106366126 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[2-(chloromethyl)cyclopentyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)NC1CCCC1CCl |
| InChI | InChI=1S/C11H18ClNO/c1-7-5-9(7)11(14)13-10-4-2-3-8(10)6-12/h7-10H,2-6H2,1H3,(H,13,14) |
| InChIKey | LMOLGRHSPPNOED-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|