C15H19Br2NO2 — CID 106367431
4-bromo-N-[2-(bromomethyl)cyclohexyl]-2-methoxybenzamide (PubChem CID 106367431) has the molecular formula C15H19Br2NO2 and a molecular weight of 405.13 g/mol. Its IUPAC name is 4-bromo-N-[2-(bromomethyl)cyclohexyl]-2-methoxybenzamide.
| Compound Name | 4-bromo-N-[2-(bromomethyl)cyclohexyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 106367431 |
| Molecular Formula | C15H19Br2NO2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-bromo-N-[2-(bromomethyl)cyclohexyl]-2-methoxybenzamide |
| SMILES | COc1cc(Br)ccc1C(=O)NC1CCCCC1CBr |
| InChI | InChI=1S/C15H19Br2NO2/c1-20-14-8-11(17)6-7-12(14)15(19)18-13-5-3-2-4-10(13)9-16/h6-8,10,13H,2-5,9H2,1H3,(H,18,19) |
| InChIKey | AXXIQQHSCDZTCV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|