C14H23NO5 — CID 10636875
2-O-ethyl 4-O-methyl (2S,3S,4S)-2-methyl-3-(2-methylpropyl)-5-oxopyrrolidine-2,4-dicarboxylate (PubChem CID 10636875) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl (2S,3S,4S)-2-methyl-3-(2-methylpropyl)-5-oxopyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl (2S,3S,4S)-2-methyl-3-(2-methylpropyl)-5-oxopyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10636875 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-O-ethyl 4-O-methyl (2S,3S,4S)-2-methyl-3-(2-methylpropyl)-5-oxopyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(C)NC(=O)[C@@H](C(=O)OC)[C@@H]1CC(C)C |
| InChI | InChI=1S/C14H23NO5/c1-6-20-13(18)14(4)9(7-8(2)3)10(11(16)15-14)12(17)19-5/h8-10H,6-7H2,1-5H3,(H,15,16)/t9-,10-,14-/m0/s1 |
| InChIKey | WHTVCBIBEZXXMO-BHDSKKPTSA-N |
| XLogP | 0.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|