C13H14F3N3O — CID 106369393
4-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 106369393) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106369393 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCc1cnc(CNc2ccc(N)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C13H14F3N3O/c1-2-9-6-19-12(20-9)7-18-8-3-4-11(17)10(5-8)13(14,15)16/h3-6,18H,2,7,17H2,1H3 |
| InChIKey | XMHQEAXXXKNYQU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|