C11H19N3O — CID 106369501
N-[(5-methyl-1,3-oxazol-2-yl)methyl]azepan-4-amine (PubChem CID 106369501) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]azepan-4-amine.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]azepan-4-amine |
|---|---|
| PubChem CID | 106369501 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]azepan-4-amine |
| SMILES | Cc1cnc(CNC2CCCNCC2)o1 |
| InChI | InChI=1S/C11H19N3O/c1-9-7-14-11(15-9)8-13-10-3-2-5-12-6-4-10/h7,10,12-13H,2-6,8H2,1H3 |
| InChIKey | CLWCJJIRNHWSLM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |