C13H21N3O2 — CID 106370575
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]azepane-1-carboxamide (PubChem CID 106370575) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]azepane-1-carboxamide.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 106370575 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]azepane-1-carboxamide |
| SMILES | CCc1cnc(CNC(=O)N2CCCCCC2)o1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-11-9-14-12(18-11)10-15-13(17)16-7-5-3-4-6-8-16/h9H,2-8,10H2,1H3,(H,15,17) |
| InChIKey | HEFLCKHURJKMKF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |