C16H24N2OSi — CID 106371023
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine (PubChem CID 106371023) has the molecular formula C16H24N2OSi and a molecular weight of 288.47 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
|---|---|
| PubChem CID | 106371023 |
| Molecular Formula | C16H24N2OSi |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
| SMILES | CCc1cnc(CNCc2ccc([Si](C)(C)C)cc2)o1 |
| InChI | InChI=1S/C16H24N2OSi/c1-5-14-11-18-16(19-14)12-17-10-13-6-8-15(9-7-13)20(2,3)4/h6-9,11,17H,5,10,12H2,1-4H3 |
| InChIKey | FCMDUEIPAZIFPK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|