About 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide
4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide (PubChem CID 106372478) has the molecular formula C13H14FN3OS
and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide.
Molecular Properties
| Compound Name | 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide |
| PubChem CID | 106372478 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide |
| SMILES | CCc1cnc(CNc2ccc(C(N)=S)c(F)c2)o1 |
| InChI | InChI=1S/C13H14FN3OS/c1-2-9-6-17-12(18-9)7-16-8-3-4-10(13(15)19)11(14)5-8/h3-6,16H,2,7H2,1H3,(H2,15,19) |
| InChIKey | AOXSLJUVBCRACO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide?
The IUPAC name of 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide (CID 106372478) is 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide.
What is the SMILES notation for 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide?
The canonical SMILES for 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide is CCc1cnc(CNc2ccc(C(N)=S)c(F)c2)o1.
What is the InChIKey of 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide?
The InChIKey is AOXSLJUVBCRACO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3OS/c1-2-9-6-17-12(18-9)7-16-8-3-4-10(13(15)19)11(14)5-8/h3-6,16H,2,7H2,1H3,(H2,15,19).
What are the key properties of 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide?
4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide has a molecular weight of 279.34 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-2-fluorobenzenecarbothioamide is sourced from PubChem (CID 106372478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).