C13H12F3N3OS — CID 106372489
5-[(5-methyl-1,3-oxazol-2-yl)methylamino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 106372489) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 5-[(5-methyl-1,3-oxazol-2-yl)methylamino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 5-[(5-methyl-1,3-oxazol-2-yl)methylamino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106372489 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-[(5-methyl-1,3-oxazol-2-yl)methylamino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | Cc1cnc(CNc2ccc(C(F)(F)F)c(C(N)=S)c2)o1 |
| InChI | InChI=1S/C13H12F3N3OS/c1-7-5-19-11(20-7)6-18-8-2-3-10(13(14,15)16)9(4-8)12(17)21/h2-5,18H,6H2,1H3,(H2,17,21) |
| InChIKey | RXKYWNUDWCREMW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|